C24H46O6Si — CID 10072878
[(3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2R)-2-methoxycyclohex-3-ene-1-carboxylate (PubChem CID 10072878) has the molecular formula C24H46O6Si and a molecular weight of 458.71 g/mol. Its IUPAC name is [(3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2R)-2-methoxycyclohex-3-ene-1-carboxylate.
| Compound Name | [(3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2R)-2-methoxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10072878 |
| Molecular Formula | C24H46O6Si |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | [(3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2R)-2-methoxycyclohex-3-ene-1-carboxylate |
| SMILES | COCO[C@@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)[C@@H](OC(=O)[C@H]1CCC=C[C@H]1OC)C(C)C |
| InChI | InChI=1S/C24H46O6Si/c1-17(2)21(30-23(25)19-13-11-12-14-20(19)27-8)22(28-16-26-7)18(3)15-29-31(9,10)24(4,5)6/h12,14,17-22H,11,13,15-16H2,1-10H3/t18-,19+,20-,21+,22+/m1/s1 |
| InChIKey | HLFIOUPQIKYUEI-TWGBQZSLSA-N |
| XLogP | 5.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|