C20H38O6Si — CID 11112197
methyl 2-[(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-dimethoxyethyl)-3,6-dihydro-2H-pyran-3-yl]propanoate (PubChem CID 11112197) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is methyl 2-[(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-dimethoxyethyl)-3,6-dihydro-2H-pyran-3-yl]propanoate.
| Compound Name | methyl 2-[(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-dimethoxyethyl)-3,6-dihydro-2H-pyran-3-yl]propanoate |
|---|---|
| PubChem CID | 11112197 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | methyl 2-[(2R,3R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,2-dimethoxyethyl)-3,6-dihydro-2H-pyran-3-yl]propanoate |
| SMILES | COC(=O)C(C)[C@H]1C=C[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1CC(OC)OC |
| InChI | InChI=1S/C20H38O6Si/c1-14(19(21)24-7)16-11-10-15(13-25-27(8,9)20(2,3)4)26-17(16)12-18(22-5)23-6/h10-11,14-18H,12-13H2,1-9H3/t14?,15-,16+,17+/m0/s1 |
| InChIKey | DBBZKIVCVWGICM-GYXHSTLNSA-N |
| XLogP | 3.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|