C24H46O6Si — CID 53247874
ethyl 2-[(2R,3S,6R)-6-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(methoxymethoxy)oxan-2-yl]acetate (PubChem CID 53247874) has the molecular formula C24H46O6Si and a molecular weight of 458.71 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,6R)-6-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(methoxymethoxy)oxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S,6R)-6-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(methoxymethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 53247874 |
| Molecular Formula | C24H46O6Si |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | ethyl 2-[(2R,3S,6R)-6-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(methoxymethoxy)oxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1O[C@@H](/C=C/CCC[C@H](C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1OCOC |
| InChI | InChI=1S/C24H46O6Si/c1-9-27-23(25)17-22-21(28-18-26-6)16-15-20(29-22)14-12-10-11-13-19(2)30-31(7,8)24(3,4)5/h12,14,19-22H,9-11,13,15-18H2,1-8H3/b14-12+/t19-,20-,21-,22+/m0/s1 |
| InChIKey | JDZQYFKMJMJJCU-IDKITSOMSA-N |
| XLogP | 5.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|