C24H46O7Si — CID 46894825
2-[(2R,3R,6S)-6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid (PubChem CID 46894825) has the molecular formula C24H46O7Si and a molecular weight of 474.71 g/mol. Its IUPAC name is 2-[(2R,3R,6S)-6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,6S)-6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 46894825 |
| Molecular Formula | C24H46O7Si |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2-[(2R,3R,6S)-6-[(E,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-3-(2-methoxyethoxymethoxy)oxan-2-yl]acetic acid |
| SMILES | COCCOCO[C@@H]1CC[C@@H](/C=C/CCC[C@@H](C)O[Si](C)(C)C(C)(C)C)O[C@@H]1CC(=O)O |
| InChI | InChI=1S/C24H46O7Si/c1-19(31-32(6,7)24(2,3)4)11-9-8-10-12-20-13-14-21(22(30-20)17-23(25)26)29-18-28-16-15-27-5/h10,12,19-22H,8-9,11,13-18H2,1-7H3,(H,25,26)/b12-10+/t19-,20-,21-,22-/m1/s1 |
| InChIKey | QRBVOXAXEYMEKA-BEEGJJNNSA-N |
| XLogP | 5.15 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|