C26H50O5Si — CID 10367471
[(E,3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylhept-6-enyl] 2,2-dimethylpropanoate (PubChem CID 10367471) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is [(E,3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylhept-6-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylhept-6-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10367471 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | [(E,3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylhept-6-enyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](CC/C=C/[C@H]1OC(C)(C)OC[C@@H]1CO[Si](C)(C)C(C)(C)C)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H50O5Si/c1-20(16-17-28-23(27)24(2,3)4)14-12-13-15-22-21(18-29-26(8,9)31-22)19-30-32(10,11)25(5,6)7/h13,15,20-22H,12,14,16-19H2,1-11H3/b15-13+/t20-,21-,22-/m1/s1 |
| InChIKey | RDHDODRQCDRZSR-KIVDGJLYSA-N |
| XLogP | 6.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|