C25H44O6Si — CID 139249722
methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(2S)-2-hydroxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-6,6-dimethylhept-2-en-4-ynoate (PubChem CID 139249722) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(2S)-2-hydroxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-6,6-dimethylhept-2-en-4-ynoate.
| Compound Name | methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(2S)-2-hydroxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-6,6-dimethylhept-2-en-4-ynoate |
|---|---|
| PubChem CID | 139249722 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | methyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-[(2S)-2-hydroxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-6,6-dimethylhept-2-en-4-ynoate |
| SMILES | COC(=O)/C=C(/C#CC(C)(C)CO[Si](C)(C)C(C)(C)C)C[C@H](O)C[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C25H44O6Si/c1-18-21(31-25(7,8)30-18)16-20(26)14-19(15-22(27)28-9)12-13-24(5,6)17-29-32(10,11)23(2,3)4/h15,18,20-21,26H,14,16-17H2,1-11H3/b19-15-/t18-,20+,21-/m1/s1 |
| InChIKey | XKPSPTPSGSMNNT-HMRMMTODSA-N |
| XLogP | 4.82 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|