C27H50O5Si — CID 11846445
(1R,2S,3E,7S,18S)-2-[tert-butyl(dimethyl)silyl]oxy-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one (PubChem CID 11846445) has the molecular formula C27H50O5Si and a molecular weight of 482.78 g/mol. Its IUPAC name is (1R,2S,3E,7S,18S)-2-[tert-butyl(dimethyl)silyl]oxy-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one.
| Compound Name | (1R,2S,3E,7S,18S)-2-[tert-butyl(dimethyl)silyl]oxy-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one |
|---|---|
| PubChem CID | 11846445 |
| Molecular Formula | C27H50O5Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | (1R,2S,3E,7S,18S)-2-[tert-butyl(dimethyl)silyl]oxy-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one |
| SMILES | C[C@H]1CCCCCCCCCC[C@@H]2OC(C)(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C27H50O5Si/c1-21-17-15-13-11-9-10-12-14-16-18-22-25(31-27(5,6)30-22)23(19-20-24(28)29-21)32-33(7,8)26(2,3)4/h19-23,25H,9-18H2,1-8H3/b20-19+/t21-,22-,23-,25+/m0/s1 |
| InChIKey | XEPKESDJEALIRL-LKOUAHAASA-N |
| XLogP | 7.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|