C24H42O6Si — CID 11691025
ethyl (E)-6-[2-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-1,3-dioxolan-2-yl]-4-hydroxyhex-2-en-5-ynoate (PubChem CID 11691025) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is ethyl (E)-6-[2-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-1,3-dioxolan-2-yl]-4-hydroxyhex-2-en-5-ynoate.
| Compound Name | ethyl (E)-6-[2-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-1,3-dioxolan-2-yl]-4-hydroxyhex-2-en-5-ynoate |
|---|---|
| PubChem CID | 11691025 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | ethyl (E)-6-[2-[(6S)-6-[tert-butyl(dimethyl)silyl]oxyheptyl]-1,3-dioxolan-2-yl]-4-hydroxyhex-2-en-5-ynoate |
| SMILES | CCOC(=O)/C=C/C(O)C#CC1(CCCCC[C@H](C)O[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C24H42O6Si/c1-8-27-22(26)14-13-21(25)15-17-24(28-18-19-29-24)16-11-9-10-12-20(2)30-31(6,7)23(3,4)5/h13-14,20-21,25H,8-12,16,18-19H2,1-7H3/b14-13+/t20-,21?/m0/s1 |
| InChIKey | ZRNRXZAKHZFGPY-YMFVNDIESA-N |
| XLogP | 4.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|