About [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate
[2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate (PubChem CID 45102060) has the molecular formula C27H54O4Si
and a molecular weight of 470.81 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate |
| PubChem CID | 45102060 |
| Molecular Formula | C27H54O4Si |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O4Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(29)30-24-25(23-28)31-32(5,6)27(2,3)4/h14-15,25,28H,7-13,16-24H2,1-6H3/b15-14- |
| InChIKey | PXLRRZCNGJIQPC-PFONDFGASA-N |
| XLogP | 7.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate?
The IUPAC name of [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate (CID 45102060) is [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate.
What is the SMILES notation for [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate?
The canonical SMILES for [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CO)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate?
The InChIKey is PXLRRZCNGJIQPC-PFONDFGASA-N. The full InChI is InChI=1S/C27H54O4Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(29)30-24-25(23-28)31-32(5,6)27(2,3)4/h14-15,25,28H,7-13,16-24H2,1-6H3/b15-14-.
What are the key properties of [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate?
[2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate has a molecular weight of 470.81 g/mol, XLogP of 7.95, 20 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl] (Z)-octadec-9-enoate is sourced from PubChem (CID 45102060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).