About (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate
(2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate (PubChem CID 12178130) has the molecular formula C21H40O4
and a molecular weight of 356.50 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate |
| PubChem CID | 12178130 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CO)O |
| InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-/t20-/m0/s1 |
| InChIKey | RZRNAYUHWVFMIP-QJRAZLAKSA-N |
| XLogP | 6.50 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | 315 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate?
The IUPAC name of (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate (CID 12178130) is [(2S)-2,3-dihydroxypropyl] (Z)-octadec-9-enoate.
What is the SMILES notation for (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate?
The canonical SMILES for (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CO)O.
What is the InChIKey of (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate?
The InChIKey is RZRNAYUHWVFMIP-QJRAZLAKSA-N. The full InChI is InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-/t20-/m0/s1.
What are the key properties of (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate?
(2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate has a molecular weight of 356.50 g/mol, XLogP of 6.50, 19 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2s)-2,3-Dihydroxypropyl (9z)-Octadec-9-Enoate is sourced from PubChem (CID 12178130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).