C16H29IO4Si — CID 24766120
[(2R)-4-oxobutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate (PubChem CID 24766120) has the molecular formula C16H29IO4Si and a molecular weight of 440.39 g/mol. Its IUPAC name is [(2R)-4-oxobutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate.
| Compound Name | [(2R)-4-oxobutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate |
|---|---|
| PubChem CID | 24766120 |
| Molecular Formula | C16H29IO4Si |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | [(2R)-4-oxobutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate |
| SMILES | C[C@H](CC=O)OC(=O)CC[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29IO4Si/c1-13(10-12-18)20-15(19)8-7-14(9-11-17)21-22(5,6)16(2,3)4/h9,11-14H,7-8,10H2,1-6H3/b11-9+/t13-,14+/m1/s1 |
| InChIKey | GPSFPSYROPWJBC-CACDNMLQSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|