C15H29IO3Si — CID 11315885
ethyl (E,3S)-3-[diethyl(propan-2-yl)silyl]oxy-6-iodohex-5-enoate (PubChem CID 11315885) has the molecular formula C15H29IO3Si and a molecular weight of 412.38 g/mol. Its IUPAC name is ethyl (E,3S)-3-[diethyl(propan-2-yl)silyl]oxy-6-iodohex-5-enoate.
| Compound Name | ethyl (E,3S)-3-[diethyl(propan-2-yl)silyl]oxy-6-iodohex-5-enoate |
|---|---|
| PubChem CID | 11315885 |
| Molecular Formula | C15H29IO3Si |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | ethyl (E,3S)-3-[diethyl(propan-2-yl)silyl]oxy-6-iodohex-5-enoate |
| SMILES | CCOC(=O)C[C@H](C/C=C/I)O[Si](CC)(CC)C(C)C |
| InChI | InChI=1S/C15H29IO3Si/c1-6-18-15(17)12-14(10-9-11-16)19-20(7-2,8-3)13(4)5/h9,11,13-14H,6-8,10,12H2,1-5H3/b11-9+/t14-/m0/s1 |
| InChIKey | OULGLCMVPSDUBY-MARXPDLDSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|