C12H23IO3Si — CID 10861578
methyl (Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enoate (PubChem CID 10861578) has the molecular formula C12H23IO3Si and a molecular weight of 370.30 g/mol. Its IUPAC name is methyl (Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enoate.
| Compound Name | methyl (Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enoate |
|---|---|
| PubChem CID | 10861578 |
| Molecular Formula | C12H23IO3Si |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | methyl (Z,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enoate |
| SMILES | COC(=O)C[C@H](/C=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H23IO3Si/c1-12(2,3)17(5,6)16-10(7-8-13)9-11(14)15-4/h7-8,10H,9H2,1-6H3/b8-7-/t10-/m0/s1 |
| InChIKey | XVFYFRSGQAJBFW-DMEOUFDRSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|