C15H25IO3Si — CID 46939260
3-[ethenyl(dimethyl)silyl]oxyhex-5-enyl (Z)-5-iodopent-4-enoate (PubChem CID 46939260) has the molecular formula C15H25IO3Si and a molecular weight of 408.35 g/mol. Its IUPAC name is 3-[ethenyl(dimethyl)silyl]oxyhex-5-enyl (Z)-5-iodopent-4-enoate.
| Compound Name | 3-[ethenyl(dimethyl)silyl]oxyhex-5-enyl (Z)-5-iodopent-4-enoate |
|---|---|
| PubChem CID | 46939260 |
| Molecular Formula | C15H25IO3Si |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3-[ethenyl(dimethyl)silyl]oxyhex-5-enyl (Z)-5-iodopent-4-enoate |
| SMILES | C=CCC(CCOC(=O)CC/C=C\I)O[Si](C)(C)C=C |
| InChI | InChI=1S/C15H25IO3Si/c1-5-9-14(19-20(3,4)6-2)11-13-18-15(17)10-7-8-12-16/h5-6,8,12,14H,1-2,7,9-11,13H2,3-4H3/b12-8- |
| InChIKey | XTACZSXJUHNOML-WQLSENKSSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|