C17H33IO3Si — CID 11224448
[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 11224448) has the molecular formula C17H33IO3Si and a molecular weight of 440.44 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11224448 |
| Molecular Formula | C17H33IO3Si |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C(I)C[C@H](CCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33IO3Si/c1-13(18)12-14(21-22(8,9)17(5,6)7)10-11-20-15(19)16(2,3)4/h14H,1,10-12H2,2-9H3/t14-/m0/s1 |
| InChIKey | OOPCWECCPXJTDY-AWEZNQCLSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|