C18H38O3Si2 — CID 11233669
[(3R)-5-(trimethylsilylmethyl)-3-trimethylsilyloxyhex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 11233669) has the molecular formula C18H38O3Si2 and a molecular weight of 358.67 g/mol. Its IUPAC name is [(3R)-5-(trimethylsilylmethyl)-3-trimethylsilyloxyhex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R)-5-(trimethylsilylmethyl)-3-trimethylsilyloxyhex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11233669 |
| Molecular Formula | C18H38O3Si2 |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | [(3R)-5-(trimethylsilylmethyl)-3-trimethylsilyloxyhex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C[C@H](CCOC(=O)C(C)(C)C)O[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C18H38O3Si2/c1-15(14-22(5,6)7)13-16(21-23(8,9)10)11-12-20-17(19)18(2,3)4/h16H,1,11-14H2,2-10H3/t16-/m0/s1 |
| InChIKey | VCOVIAYGZMUTHH-INIZCTEOSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|