C16H32O3Si — CID 46201683
[(3R)-1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl] butanoate (PubChem CID 46201683) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is [(3R)-1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl] butanoate.
| Compound Name | [(3R)-1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl] butanoate |
|---|---|
| PubChem CID | 46201683 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | [(3R)-1-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl] butanoate |
| SMILES | C=CC[C@H](CCO[Si](C)(C)C(C)(C)C)OC(=O)CCC |
| InChI | InChI=1S/C16H32O3Si/c1-8-10-14(19-15(17)11-9-2)12-13-18-20(6,7)16(3,4)5/h8,14H,1,9-13H2,2-7H3/t14-/m1/s1 |
| InChIKey | ZQZVRHLGECDZDF-CQSZACIVSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|