C19H36O3Si — CID 134980795
ethyl (4E,6Z,10S)-10-[tert-butyl(dimethyl)silyl]oxyundeca-4,6-dienoate (PubChem CID 134980795) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is ethyl (4E,6Z,10S)-10-[tert-butyl(dimethyl)silyl]oxyundeca-4,6-dienoate.
| Compound Name | ethyl (4E,6Z,10S)-10-[tert-butyl(dimethyl)silyl]oxyundeca-4,6-dienoate |
|---|---|
| PubChem CID | 134980795 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | ethyl (4E,6Z,10S)-10-[tert-butyl(dimethyl)silyl]oxyundeca-4,6-dienoate |
| SMILES | CCOC(=O)CC/C=C/C=C\CC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-8-21-18(20)16-14-12-10-9-11-13-15-17(2)22-23(6,7)19(3,4)5/h9-12,17H,8,13-16H2,1-7H3/b11-9-,12-10+/t17-/m0/s1 |
| InChIKey | QHXAMDWUVPMJCO-ABOWTFMHSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|