C18H32O3Si — CID 134887280
ethyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxydec-3-en-5-ynoate (PubChem CID 134887280) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is ethyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxydec-3-en-5-ynoate.
| Compound Name | ethyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxydec-3-en-5-ynoate |
|---|---|
| PubChem CID | 134887280 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | ethyl (E,9S)-9-[tert-butyl(dimethyl)silyl]oxydec-3-en-5-ynoate |
| SMILES | CCOC(=O)C/C=C/C#CCC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-8-20-17(19)15-13-11-9-10-12-14-16(2)21-22(6,7)18(3,4)5/h11,13,16H,8,12,14-15H2,1-7H3/b13-11+/t16-/m0/s1 |
| InChIKey | STHLMLIYYXGBCH-BYIUCRAPSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|