C27H44O3Si — CID 138982537
methyl (5Z,8Z,11Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,16-tetraen-14-ynoate (PubChem CID 138982537) has the molecular formula C27H44O3Si and a molecular weight of 444.73 g/mol. Its IUPAC name is methyl (5Z,8Z,11Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,16-tetraen-14-ynoate.
| Compound Name | methyl (5Z,8Z,11Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,16-tetraen-14-ynoate |
|---|---|
| PubChem CID | 138982537 |
| Molecular Formula | C27H44O3Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | methyl (5Z,8Z,11Z,16E,18R)-18-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,16-tetraen-14-ynoate |
| SMILES | CC[C@H](/C=C/C#CC/C=C\C/C=C\C/C=C\CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O3Si/c1-8-25(30-31(6,7)27(2,3)4)23-21-19-17-15-13-11-9-10-12-14-16-18-20-22-24-26(28)29-5/h10-13,16,18,21,23,25H,8-9,14-15,20,22,24H2,1-7H3/b12-10-,13-11-,18-16-,23-21+/t25-/m1/s1 |
| InChIKey | WSRRSLQILVGZQH-SRNIAJSSSA-N |
| XLogP | 7.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|