C24H38O3Si — CID 135063112
(10Z,12S,17S)-12-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one (PubChem CID 135063112) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is (10Z,12S,17S)-12-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one.
| Compound Name | (10Z,12S,17S)-12-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one |
|---|---|
| PubChem CID | 135063112 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (10Z,12S,17S)-12-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-1-oxacycloheptadec-10-en-13,15-diyn-2-one |
| SMILES | CC[C@H]1C#CC#C[C@@H](O[Si](C)(C)C(C)(C)C)/C=C\CCCCCCCC(=O)O1 |
| InChI | InChI=1S/C24H38O3Si/c1-7-21-17-15-16-19-22(27-28(5,6)24(2,3)4)18-13-11-9-8-10-12-14-20-23(25)26-21/h13,18,21-22H,7-12,14,20H2,1-6H3/b18-13-/t21-,22-/m0/s1 |
| InChIKey | NLZVUBGYMYHMIX-ZJKDUQGASA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|