C20H38O3Si — CID 12988294
(9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoic acid (PubChem CID 12988294) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoic acid.
| Compound Name | (9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoic acid |
|---|---|
| PubChem CID | 12988294 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoic acid |
| SMILES | C[C@@H](/C=C/C=C\CCCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-18(23-24(5,6)20(2,3)4)16-14-12-10-8-7-9-11-13-15-17-19(21)22/h10,12,14,16,18H,7-9,11,13,15,17H2,1-6H3,(H,21,22)/b12-10-,16-14+/t18-/m0/s1 |
| InChIKey | NKMMOOPYUSKRRV-MBOWCQTKSA-N |
| XLogP | 6.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|