C22H39BrO3Si — CID 134885160
[(E,12S)-14-bromo-12-[tert-butyl(dimethyl)silyl]oxytetradec-10-en-13-ynyl] acetate (PubChem CID 134885160) has the molecular formula C22H39BrO3Si and a molecular weight of 459.54 g/mol. Its IUPAC name is [(E,12S)-14-bromo-12-[tert-butyl(dimethyl)silyl]oxytetradec-10-en-13-ynyl] acetate.
| Compound Name | [(E,12S)-14-bromo-12-[tert-butyl(dimethyl)silyl]oxytetradec-10-en-13-ynyl] acetate |
|---|---|
| PubChem CID | 134885160 |
| Molecular Formula | C22H39BrO3Si |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [(E,12S)-14-bromo-12-[tert-butyl(dimethyl)silyl]oxytetradec-10-en-13-ynyl] acetate |
| SMILES | CC(=O)OCCCCCCCCC/C=C/[C@@H](C#CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H39BrO3Si/c1-20(24)25-19-15-13-11-9-7-8-10-12-14-16-21(17-18-23)26-27(5,6)22(2,3)4/h14,16,21H,7-13,15,19H2,1-6H3/b16-14+/t21-/m0/s1 |
| InChIKey | ODHABCVOPPQQJX-OZIPEELISA-N |
| XLogP | 6.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|