C29H42O3Si — CID 135071399
[(3S)-octa-4,6-diyn-3-yl] (Z,11S)-11-[tert-butyl(dimethyl)silyl]oxypentadec-9-en-12,14-diynoate (PubChem CID 135071399) has the molecular formula C29H42O3Si and a molecular weight of 466.74 g/mol. Its IUPAC name is [(3S)-octa-4,6-diyn-3-yl] (Z,11S)-11-[tert-butyl(dimethyl)silyl]oxypentadec-9-en-12,14-diynoate.
| Compound Name | [(3S)-octa-4,6-diyn-3-yl] (Z,11S)-11-[tert-butyl(dimethyl)silyl]oxypentadec-9-en-12,14-diynoate |
|---|---|
| PubChem CID | 135071399 |
| Molecular Formula | C29H42O3Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [(3S)-octa-4,6-diyn-3-yl] (Z,11S)-11-[tert-butyl(dimethyl)silyl]oxypentadec-9-en-12,14-diynoate |
| SMILES | C#CC#C[C@H](/C=C\CCCCCCCC(=O)O[C@H](C#CC#CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H42O3Si/c1-9-12-19-23-26(11-3)31-28(30)25-21-18-16-14-15-17-20-24-27(22-13-10-2)32-33(7,8)29(4,5)6/h2,20,24,26-27H,11,14-18,21,25H2,1,3-8H3/b24-20-/t26-,27+/m0/s1 |
| InChIKey | BNKSMSYSTDWQHC-WITWPIHNSA-N |
| XLogP | 6.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|