C27H44O3Si — CID 134976599
methyl (11R,12E,14Z)-11-[tert-butyl(dimethyl)silyl]oxyicosa-12,14-dien-5,8-diynoate (PubChem CID 134976599) has the molecular formula C27H44O3Si and a molecular weight of 444.73 g/mol. Its IUPAC name is methyl (11R,12E,14Z)-11-[tert-butyl(dimethyl)silyl]oxyicosa-12,14-dien-5,8-diynoate.
| Compound Name | methyl (11R,12E,14Z)-11-[tert-butyl(dimethyl)silyl]oxyicosa-12,14-dien-5,8-diynoate |
|---|---|
| PubChem CID | 134976599 |
| Molecular Formula | C27H44O3Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | methyl (11R,12E,14Z)-11-[tert-butyl(dimethyl)silyl]oxyicosa-12,14-dien-5,8-diynoate |
| SMILES | CCCCC/C=C\C=C\[C@@H](CC#CCC#CCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O3Si/c1-8-9-10-11-13-16-19-22-25(30-31(6,7)27(2,3)4)23-20-17-14-12-15-18-21-24-26(28)29-5/h13,16,19,22,25H,8-11,14,18,21,23-24H2,1-7H3/b16-13-,22-19+/t25-/m0/s1 |
| InChIKey | IFIHUEMQMVUTHW-CDSCBFCKSA-N |
| XLogP | 7.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|