C26H42O4Si — CID 11669503
methyl (8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-(2-pentoxyphenyl)oct-5-ynoate (PubChem CID 11669503) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is methyl (8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-(2-pentoxyphenyl)oct-5-ynoate.
| Compound Name | methyl (8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-(2-pentoxyphenyl)oct-5-ynoate |
|---|---|
| PubChem CID | 11669503 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | methyl (8R)-8-[tert-butyl(dimethyl)silyl]oxy-8-(2-pentoxyphenyl)oct-5-ynoate |
| SMILES | CCCCCOc1ccccc1[C@@H](CC#CCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O4Si/c1-8-9-16-21-29-23-18-15-14-17-22(23)24(30-31(6,7)26(2,3)4)19-12-10-11-13-20-25(27)28-5/h14-15,17-18,24H,8-9,11,13,16,19-21H2,1-7H3/t24-/m1/s1 |
| InChIKey | HSTPDIOADYROCV-XMMPIXPASA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|