C18H24NO4- — CID 91936589
8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-ynoate (PubChem CID 91936589) has the molecular formula C18H24NO4- and a molecular weight of 318.39 g/mol. Its IUPAC name is 8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-ynoate.
| Compound Name | 8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-ynoate |
|---|---|
| PubChem CID | 91936589 |
| Molecular Formula | C18H24NO4- |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-ynoate |
| SMILES | CCCCCOc1ncccc1C(O)CC#CCCCC(=O)[O-] |
| InChI | InChI=1S/C18H25NO4/c1-2-3-8-14-23-18-15(10-9-13-19-18)16(20)11-6-4-5-7-12-17(21)22/h9-10,13,16,20H,2-3,5,7-8,11-12,14H2,1H3,(H,21,22)/p-1 |
| InChIKey | MMNXTSNHRIKURJ-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|