C19H26O4 — CID 11645813
8-hydroxy-8-(2-pentoxyphenyl)oct-5-ynoic acid (PubChem CID 11645813) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 8-hydroxy-8-(2-pentoxyphenyl)oct-5-ynoic acid.
| Compound Name | 8-hydroxy-8-(2-pentoxyphenyl)oct-5-ynoic acid |
|---|---|
| PubChem CID | 11645813 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 8-hydroxy-8-(2-pentoxyphenyl)oct-5-ynoic acid |
| SMILES | CCCCCOc1ccccc1C(O)CC#CCCCC(=O)O |
| InChI | InChI=1S/C19H26O4/c1-2-3-10-15-23-18-13-9-8-11-16(18)17(20)12-6-4-5-7-14-19(21)22/h8-9,11,13,17,20H,2-3,5,7,10,12,14-15H2,1H3,(H,21,22) |
| InChIKey | IDMNIAMGOMKQFB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|