C25H33NO4 — CID 129010635
8-hydroxy-8-(2-octoxyquinolin-3-yl)oct-5-ynoic acid (PubChem CID 129010635) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 8-hydroxy-8-(2-octoxyquinolin-3-yl)oct-5-ynoic acid.
| Compound Name | 8-hydroxy-8-(2-octoxyquinolin-3-yl)oct-5-ynoic acid |
|---|---|
| PubChem CID | 129010635 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 8-hydroxy-8-(2-octoxyquinolin-3-yl)oct-5-ynoic acid |
| SMILES | CCCCCCCCOc1nc2ccccc2cc1C(O)CC#CCCCC(=O)O |
| InChI | InChI=1S/C25H33NO4/c1-2-3-4-5-8-13-18-30-25-21(19-20-14-11-12-15-22(20)26-25)23(27)16-9-6-7-10-17-24(28)29/h11-12,14-15,19,23,27H,2-5,7-8,10,13,16-18H2,1H3,(H,28,29) |
| InChIKey | FCPSFHNACBPQRB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|