C29H33NO4 — CID 24991101
8-hydroxy-5-methyl-8-[2-(5-phenylpentoxy)quinolin-3-yl]oct-2-ynoic acid (PubChem CID 24991101) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 8-hydroxy-5-methyl-8-[2-(5-phenylpentoxy)quinolin-3-yl]oct-2-ynoic acid.
| Compound Name | 8-hydroxy-5-methyl-8-[2-(5-phenylpentoxy)quinolin-3-yl]oct-2-ynoic acid |
|---|---|
| PubChem CID | 24991101 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 8-hydroxy-5-methyl-8-[2-(5-phenylpentoxy)quinolin-3-yl]oct-2-ynoic acid |
| SMILES | CC(CC#CC(=O)O)CCC(O)c1cc2ccccc2nc1OCCCCCc1ccccc1 |
| InChI | InChI=1S/C29H33NO4/c1-22(11-10-17-28(32)33)18-19-27(31)25-21-24-15-7-8-16-26(24)30-29(25)34-20-9-3-6-14-23-12-4-2-5-13-23/h2,4-5,7-8,12-13,15-16,21-22,27,31H,3,6,9,11,14,18-20H2,1H3,(H,32,33) |
| InChIKey | QBNDZQJXYWABAI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|