C23H27NaO4 — CID 23684920
sodium 8-hydroxy-8-(3-pentoxynaphthalen-2-yl)oct-5-ynoate (PubChem CID 23684920) has the molecular formula C23H27NaO4 and a molecular weight of 390.46 g/mol. Its IUPAC name is sodium 8-hydroxy-8-(3-pentoxynaphthalen-2-yl)oct-5-ynoate.
| Compound Name | sodium 8-hydroxy-8-(3-pentoxynaphthalen-2-yl)oct-5-ynoate |
|---|---|
| PubChem CID | 23684920 |
| Molecular Formula | C23H27NaO4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | sodium 8-hydroxy-8-(3-pentoxynaphthalen-2-yl)oct-5-ynoate |
| SMILES | CCCCCOc1cc2ccccc2cc1C(O)CC#CCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C23H28O4.Na/c1-2-3-10-15-27-22-17-19-12-9-8-11-18(19)16-20(22)21(24)13-6-4-5-7-14-23(25)26;/h8-9,11-12,16-17,21,24H,2-3,5,7,10,13-15H2,1H3,(H,25,26);/q;+1/p-1 |
| InChIKey | KTKOMBSDIQTVAJ-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|