C18H26NNaO4 — CID 23686958
sodium (Z)-8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-enoate (PubChem CID 23686958) has the molecular formula C18H26NNaO4 and a molecular weight of 343.40 g/mol. Its IUPAC name is sodium (Z)-8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-enoate.
| Compound Name | sodium (Z)-8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-enoate |
|---|---|
| PubChem CID | 23686958 |
| Molecular Formula | C18H26NNaO4 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | sodium (Z)-8-hydroxy-8-(2-pentoxy-3-pyridinyl)oct-5-enoate |
| SMILES | CCCCCOc1ncccc1C(O)C/C=C\CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H27NO4.Na/c1-2-3-8-14-23-18-15(10-9-13-19-18)16(20)11-6-4-5-7-12-17(21)22;/h4,6,9-10,13,16,20H,2-3,5,7-8,11-12,14H2,1H3,(H,21,22);/q;+1/p-1/b6-4-; |
| InChIKey | VKOWDSWRQGUYNW-YHSAGPEESA-M |
| XLogP | -0.45 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|