About docos-13-ynoate;bis(trimethylazanium);chloride
docos-13-ynoate;bis(trimethylazanium);chloride (PubChem CID 141426777) has the molecular formula C28H59ClN2O2
and a molecular weight of 491.25 g/mol. Its IUPAC name is docos-13-ynoate;bis(trimethylazanium);chloride.
Molecular Properties
| Compound Name | docos-13-ynoate;bis(trimethylazanium);chloride |
| PubChem CID | 141426777 |
| Molecular Formula | C28H59ClN2O2 |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 490.43 |
| IUPAC Name | docos-13-ynoate;bis(trimethylazanium);chloride |
| SMILES | CCCCCCCCC#CCCCCCCCCCCCC(=O)[O-].C[NH+](C)C.C[NH+](C)C.[Cl-] |
| InChI | InChI=1S/C22H40O2.2C3H9N.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;2*1-4(2)3;/h2-8,11-21H2,1H3,(H,23,24);2*1-3H3;1H |
| InChIKey | HOQFCRFEHBGNDB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze docos-13-ynoate;bis(trimethylazanium);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docos-13-ynoate;bis(trimethylazanium);chloride?
The IUPAC name of docos-13-ynoate;bis(trimethylazanium);chloride (CID 141426777) is docos-13-ynoate;bis(trimethylazanium);chloride.
What is the SMILES notation for docos-13-ynoate;bis(trimethylazanium);chloride?
The canonical SMILES for docos-13-ynoate;bis(trimethylazanium);chloride is CCCCCCCCC#CCCCCCCCCCCCC(=O)[O-].C[NH+](C)C.C[NH+](C)C.[Cl-].
What is the InChIKey of docos-13-ynoate;bis(trimethylazanium);chloride?
The InChIKey is HOQFCRFEHBGNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O2.2C3H9N.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;2*1-4(2)3;/h2-8,11-21H2,1H3,(H,23,24);2*1-3H3;1H.
What are the key properties of docos-13-ynoate;bis(trimethylazanium);chloride?
docos-13-ynoate;bis(trimethylazanium);chloride has a molecular weight of 491.25 g/mol, XLogP of 0.31, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for docos-13-ynoate;bis(trimethylazanium);chloride is sourced from PubChem (CID 141426777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).