About acetonitrile;dodecanoate;trimethylazanium
acetonitrile;dodecanoate;trimethylazanium (PubChem CID 19102381) has the molecular formula C17H36N2O2
and a molecular weight of 300.49 g/mol. Its IUPAC name is acetonitrile;dodecanoate;trimethylazanium.
Molecular Properties
| Compound Name | acetonitrile;dodecanoate;trimethylazanium |
| PubChem CID | 19102381 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | acetonitrile;dodecanoate;trimethylazanium |
| SMILES | CC#N.CCCCCCCCCCCC(=O)[O-].C[NH+](C)C |
| InChI | InChI=1S/C12H24O2.C3H9N.C2H3N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4(2)3;1-2-3/h2-11H2,1H3,(H,13,14);1-3H3;1H3 |
| InChIKey | KPFNLUVDCHBPDY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;dodecanoate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;dodecanoate;trimethylazanium?
The IUPAC name of acetonitrile;dodecanoate;trimethylazanium (CID 19102381) is acetonitrile;dodecanoate;trimethylazanium.
What is the SMILES notation for acetonitrile;dodecanoate;trimethylazanium?
The canonical SMILES for acetonitrile;dodecanoate;trimethylazanium is CC#N.CCCCCCCCCCCC(=O)[O-].C[NH+](C)C.
What is the InChIKey of acetonitrile;dodecanoate;trimethylazanium?
The InChIKey is KPFNLUVDCHBPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C3H9N.C2H3N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-4(2)3;1-2-3/h2-11H2,1H3,(H,13,14);1-3H3;1H3.
What are the key properties of acetonitrile;dodecanoate;trimethylazanium?
acetonitrile;dodecanoate;trimethylazanium has a molecular weight of 300.49 g/mol, XLogP of 1.95, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;dodecanoate;trimethylazanium is sourced from PubChem (CID 19102381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).