C27H49IO4Si2 — CID 102463821
methyl (8S,9S,11R,12E,14Z)-8-iodo-9,11-bis(trimethylsilyloxy)icosa-12,14-dien-5-ynoate (PubChem CID 102463821) has the molecular formula C27H49IO4Si2 and a molecular weight of 620.76 g/mol. Its IUPAC name is methyl (8S,9S,11R,12E,14Z)-8-iodo-9,11-bis(trimethylsilyloxy)icosa-12,14-dien-5-ynoate.
| Compound Name | methyl (8S,9S,11R,12E,14Z)-8-iodo-9,11-bis(trimethylsilyloxy)icosa-12,14-dien-5-ynoate |
|---|---|
| PubChem CID | 102463821 |
| Molecular Formula | C27H49IO4Si2 |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | methyl (8S,9S,11R,12E,14Z)-8-iodo-9,11-bis(trimethylsilyloxy)icosa-12,14-dien-5-ynoate |
| SMILES | CCCCC/C=C\C=C\[C@@H](C[C@H](O[Si](C)(C)C)[C@@H](I)CC#CCCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C27H49IO4Si2/c1-9-10-11-12-13-14-17-20-24(31-33(3,4)5)23-26(32-34(6,7)8)25(28)21-18-15-16-19-22-27(29)30-2/h13-14,17,20,24-26H,9-12,16,19,21-23H2,1-8H3/b14-13-,20-17+/t24-,25-,26-/m0/s1 |
| InChIKey | BQSFPCXOESJYDZ-BYCVDILWSA-N |
| XLogP | 8.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|