C33H62O4Si2 — CID 134980793
methyl (5E,8Z,10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-5,8,10,14-tetraenoate (PubChem CID 134980793) has the molecular formula C33H62O4Si2 and a molecular weight of 579.03 g/mol. Its IUPAC name is methyl (5E,8Z,10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-5,8,10,14-tetraenoate.
| Compound Name | methyl (5E,8Z,10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 134980793 |
| Molecular Formula | C33H62O4Si2 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.42 |
| IUPAC Name | methyl (5E,8Z,10E,12S,14Z)-12,20-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-5,8,10,14-tetraenoate |
| SMILES | COC(=O)CCC/C=C/C/C=C\C=C\[C@H](C/C=C\CCCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O4Si2/c1-32(2,3)38(8,9)36-29-25-21-17-16-19-23-27-30(37-39(10,11)33(4,5)6)26-22-18-14-12-13-15-20-24-28-31(34)35-7/h13-15,18-19,22-23,26,30H,12,16-17,20-21,24-25,27-29H2,1-11H3/b15-13+,18-14-,23-19-,26-22+/t30-/m1/s1 |
| InChIKey | DDBYSIABWXESQV-GZOURDTHSA-N |
| XLogP | 10.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|