C27H52O3Si — CID 86678084
methyl (11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoate (PubChem CID 86678084) has the molecular formula C27H52O3Si and a molecular weight of 452.80 g/mol. Its IUPAC name is methyl (11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoate.
| Compound Name | methyl (11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoate |
|---|---|
| PubChem CID | 86678084 |
| Molecular Formula | C27H52O3Si |
| Molecular Weight | 452.80 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | methyl (11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O3Si/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(24-26(28)29-5)30-31(6,7)27(2,3)4/h12-13,15-16,25H,8-11,14,17-24H2,1-7H3/b13-12-,16-15- |
| InChIKey | YLZXDNBBXHOHFO-QGLGPCELSA-N |
| XLogP | 8.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.80 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|