C37H52O5Si — CID 100982637
methyl (5E,9E)-10-[3-[(E)-8-[tert-butyl(diphenyl)silyl]oxyoct-2-enyl]oxiran-2-yl]-8-hydroxydeca-5,9-dienoate (PubChem CID 100982637) has the molecular formula C37H52O5Si and a molecular weight of 604.90 g/mol. Its IUPAC name is methyl (5E,9E)-10-[3-[(E)-8-[tert-butyl(diphenyl)silyl]oxyoct-2-enyl]oxiran-2-yl]-8-hydroxydeca-5,9-dienoate.
| Compound Name | methyl (5E,9E)-10-[3-[(E)-8-[tert-butyl(diphenyl)silyl]oxyoct-2-enyl]oxiran-2-yl]-8-hydroxydeca-5,9-dienoate |
|---|---|
| PubChem CID | 100982637 |
| Molecular Formula | C37H52O5Si |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | methyl (5E,9E)-10-[3-[(E)-8-[tert-butyl(diphenyl)silyl]oxyoct-2-enyl]oxiran-2-yl]-8-hydroxydeca-5,9-dienoate |
| SMILES | COC(=O)CCC/C=C/CC(O)/C=C/C1OC1C/C=C/CCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H52O5Si/c1-37(2,3)43(32-22-14-11-15-23-32,33-24-16-12-17-25-33)41-30-20-10-6-5-7-18-26-34-35(42-34)29-28-31(38)21-13-8-9-19-27-36(39)40-4/h7-8,11-18,22-25,28-29,31,34-35,38H,5-6,9-10,19-21,26-27,30H2,1-4H3/b13-8+,18-7+,29-28+ |
| InChIKey | WUVSXZVAKYNXMC-RBGSPJQDSA-N |
| XLogP | 7.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|