C23H36O4 — CID 53253746
methyl (5Z,8Z,11Z,14Z)-20-acetyloxyicosa-5,8,11,14-tetraenoate (PubChem CID 53253746) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is methyl (5Z,8Z,11Z,14Z)-20-acetyloxyicosa-5,8,11,14-tetraenoate.
| Compound Name | methyl (5Z,8Z,11Z,14Z)-20-acetyloxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 53253746 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | methyl (5Z,8Z,11Z,14Z)-20-acetyloxyicosa-5,8,11,14-tetraenoate |
| SMILES | COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCOC(C)=O |
| InChI | InChI=1S/C23H36O4/c1-22(24)27-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-23(25)26-2/h3,5-6,8-9,11-12,14H,4,7,10,13,15-21H2,1-2H3/b5-3-,8-6-,11-9-,14-12- |
| InChIKey | NIZDLUGDCOSQGV-JPURVOHMSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|