C26H42O3Si — CID 134901468
ethyl 2-[(1Z,5E)-7-[tert-butyl(dimethyl)silyl]oxydodeca-1,5-dien-3-ynyl]cyclopentene-1-carboxylate (PubChem CID 134901468) has the molecular formula C26H42O3Si and a molecular weight of 430.71 g/mol. Its IUPAC name is ethyl 2-[(1Z,5E)-7-[tert-butyl(dimethyl)silyl]oxydodeca-1,5-dien-3-ynyl]cyclopentene-1-carboxylate.
| Compound Name | ethyl 2-[(1Z,5E)-7-[tert-butyl(dimethyl)silyl]oxydodeca-1,5-dien-3-ynyl]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 134901468 |
| Molecular Formula | C26H42O3Si |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | ethyl 2-[(1Z,5E)-7-[tert-butyl(dimethyl)silyl]oxydodeca-1,5-dien-3-ynyl]cyclopentene-1-carboxylate |
| SMILES | CCCCCC(/C=C/C#C/C=C\C1=C(C(=O)OCC)CCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O3Si/c1-8-10-13-19-23(29-30(6,7)26(3,4)5)20-15-12-11-14-17-22-18-16-21-24(22)25(27)28-9-2/h14-15,17,20,23H,8-10,13,16,18-19,21H2,1-7H3/b17-14-,20-15+ |
| InChIKey | LJBULZSWTVNQKR-KIYPBSQKSA-N |
| XLogP | 7.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|