C15H22O2Si — CID 134993570
ethyl 2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]cyclopentene-1-carboxylate (PubChem CID 134993570) has the molecular formula C15H22O2Si and a molecular weight of 262.43 g/mol. Its IUPAC name is ethyl 2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]cyclopentene-1-carboxylate.
| Compound Name | ethyl 2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 134993570 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | ethyl 2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]cyclopentene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(/C=C\C#C[Si](C)(C)C)CCC1 |
| InChI | InChI=1S/C15H22O2Si/c1-5-17-15(16)14-11-8-10-13(14)9-6-7-12-18(2,3)4/h6,9H,5,8,10-11H2,1-4H3/b9-6- |
| InChIKey | JGRICOMFCJOXJT-TWGQIWQCSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|