C19H34O3Si — CID 135016356
ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyundec-4-en-6-ynoate (PubChem CID 135016356) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyundec-4-en-6-ynoate.
| Compound Name | ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyundec-4-en-6-ynoate |
|---|---|
| PubChem CID | 135016356 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyundec-4-en-6-ynoate |
| SMILES | CCCCC#C/C=C\C(CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O3Si/c1-8-10-11-12-13-14-15-17(16-18(20)21-9-2)22-23(6,7)19(3,4)5/h14-15,17H,8-11,16H2,1-7H3/b15-14- |
| InChIKey | FYQZSIVPMLOXEE-PFONDFGASA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|