C24H38O5Si — CID 135079520
diethyl 2-[(E)-4-[[(1E)-buta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate (PubChem CID 135079520) has the molecular formula C24H38O5Si and a molecular weight of 434.65 g/mol. Its IUPAC name is diethyl 2-[(E)-4-[[(1E)-buta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate.
| Compound Name | diethyl 2-[(E)-4-[[(1E)-buta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 135079520 |
| Molecular Formula | C24H38O5Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | diethyl 2-[(E)-4-[[(1E)-buta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(C/C=C/CO[Si](/C=C/C=C)(C(C)C)C(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H38O5Si/c1-9-13-19-30(20(5)6,21(7)8)29-18-15-14-17-24(16-10-2,22(25)27-11-3)23(26)28-12-4/h2,9,13-15,19-21H,1,11-12,16-18H2,3-8H3/b15-14+,19-13+ |
| InChIKey | SBASSRMPFMJSGL-XYRSRPKXSA-N |
| XLogP | 5.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|