C24H36O7Si — CID 134982423
trimethyl (1E,3E)-5-[tert-butyl(dimethyl)silyl]oxydodeca-1,3,11-trien-6-yne-1,9,9-tricarboxylate (PubChem CID 134982423) has the molecular formula C24H36O7Si and a molecular weight of 464.63 g/mol. Its IUPAC name is trimethyl (1E,3E)-5-[tert-butyl(dimethyl)silyl]oxydodeca-1,3,11-trien-6-yne-1,9,9-tricarboxylate.
| Compound Name | trimethyl (1E,3E)-5-[tert-butyl(dimethyl)silyl]oxydodeca-1,3,11-trien-6-yne-1,9,9-tricarboxylate |
|---|---|
| PubChem CID | 134982423 |
| Molecular Formula | C24H36O7Si |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | trimethyl (1E,3E)-5-[tert-butyl(dimethyl)silyl]oxydodeca-1,3,11-trien-6-yne-1,9,9-tricarboxylate |
| SMILES | C=CCC(CC#CC(/C=C/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H36O7Si/c1-10-17-24(21(26)29-6,22(27)30-7)18-13-15-19(14-11-12-16-20(25)28-5)31-32(8,9)23(2,3)4/h10-12,14,16,19H,1,17-18H2,2-9H3/b14-11+,16-12+ |
| InChIKey | JRGYNCLTMBWIJY-MHMBTURYSA-N |
| XLogP | 3.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|