C20H31IO4Si — CID 134887251
diethyl 2-[(2Z)-3-iodohepta-2,6-dienyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate (PubChem CID 134887251) has the molecular formula C20H31IO4Si and a molecular weight of 490.45 g/mol. Its IUPAC name is diethyl 2-[(2Z)-3-iodohepta-2,6-dienyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate.
| Compound Name | diethyl 2-[(2Z)-3-iodohepta-2,6-dienyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
|---|---|
| PubChem CID | 134887251 |
| Molecular Formula | C20H31IO4Si |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | diethyl 2-[(2Z)-3-iodohepta-2,6-dienyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
| SMILES | C=CCC/C(I)=C/CC(CC#C[Si](C)(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H31IO4Si/c1-7-10-12-17(21)13-15-20(18(22)24-8-2,19(23)25-9-3)14-11-16-26(4,5)6/h7,13H,1,8-10,12,14-15H2,2-6H3/b17-13- |
| InChIKey | LQJAFDAJKNBGOK-LGMDPLHJSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|