C27H50O3Si — CID 57202624
tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoate (PubChem CID 57202624) has the molecular formula C27H50O3Si and a molecular weight of 450.78 g/mol. Its IUPAC name is tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoate.
| Compound Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 57202624 |
| Molecular Formula | C27H50O3Si |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5,9,13-trimethyltetradeca-4,8,12-trienoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O3Si/c1-21(2)15-13-16-22(3)17-14-18-23(4)19-24(20-25(28)29-26(5,6)7)30-31(11,12)27(8,9)10/h15,17,19,24H,13-14,16,18,20H2,1-12H3 |
| InChIKey | CJRLSXXGJFYYLY-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|