C17H30Cl2O3Si — CID 24879850
ethyl (4Z)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dichloro-4-methylocta-4,7-dienoate (PubChem CID 24879850) has the molecular formula C17H30Cl2O3Si and a molecular weight of 381.42 g/mol. Its IUPAC name is ethyl (4Z)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dichloro-4-methylocta-4,7-dienoate.
| Compound Name | ethyl (4Z)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dichloro-4-methylocta-4,7-dienoate |
|---|---|
| PubChem CID | 24879850 |
| Molecular Formula | C17H30Cl2O3Si |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl (4Z)-3-[tert-butyl(dimethyl)silyl]oxy-8,8-dichloro-4-methylocta-4,7-dienoate |
| SMILES | CCOC(=O)CC(O[Si](C)(C)C(C)(C)C)/C(C)=C\CC=C(Cl)Cl |
| InChI | InChI=1S/C17H30Cl2O3Si/c1-8-21-16(20)12-14(13(2)10-9-11-15(18)19)22-23(6,7)17(3,4)5/h10-11,14H,8-9,12H2,1-7H3/b13-10- |
| InChIKey | NFSYWHAEMPOEFR-RAXLEYEMSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|