C20H38O4Si — CID 10547161
ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-dimethyldeca-4,8-dienoate (PubChem CID 10547161) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-dimethyldeca-4,8-dienoate.
| Compound Name | ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-dimethyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 10547161 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | ethyl (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5,9-dimethyldeca-4,8-dienoate |
| SMILES | CCOC(=O)CC(O)/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-9-23-19(22)14-18(21)13-16(2)11-10-12-17(3)15-24-25(7,8)20(4,5)6/h12-13,18,21H,9-11,14-15H2,1-8H3/b16-13+,17-12+ |
| InChIKey | QVHCQRNARLTIGW-JSHGDNENSA-N |
| XLogP | 5.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|