C25H52O3SiSn — CID 56964829
methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-tributylstannylhex-5-enoate (PubChem CID 56964829) has the molecular formula C25H52O3SiSn and a molecular weight of 547.49 g/mol. Its IUPAC name is methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-tributylstannylhex-5-enoate.
| Compound Name | methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-tributylstannylhex-5-enoate |
|---|---|
| PubChem CID | 56964829 |
| Molecular Formula | C25H52O3SiSn |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | methyl (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-tributylstannylhex-5-enoate |
| SMILES | CCCC[Sn](/C=C/[C@H](CCC(=O)OC)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C13H25O3Si.3C4H9.Sn/c1-8-11(9-10-12(14)15-5)16-17(6,7)13(2,3)4;3*1-3-4-2;/h1,8,11H,9-10H2,2-7H3;3*1,3-4H2,2H3;/t11-;;;;/m1..../s1 |
| InChIKey | VEMXHLIKTIYXKL-LOSFGHDGSA-N |
| XLogP | 8.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|