C13H25BrO3Si — CID 89058032
methyl (E,4R)-6-bromo-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate (PubChem CID 89058032) has the molecular formula C13H25BrO3Si and a molecular weight of 337.33 g/mol. Its IUPAC name is methyl (E,4R)-6-bromo-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate.
| Compound Name | methyl (E,4R)-6-bromo-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 89058032 |
| Molecular Formula | C13H25BrO3Si |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl (E,4R)-6-bromo-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
| SMILES | COC(=O)CC[C@H](/C=C/Br)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25BrO3Si/c1-13(2,3)18(5,6)17-11(9-10-14)7-8-12(15)16-4/h9-11H,7-8H2,1-6H3/b10-9+/t11-/m1/s1 |
| InChIKey | YQYUGKUIVQPGES-PBQZMEPESA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|